| Produkt-Name |
trans-3,6-endo-Methylen-1,2,3,6-tetrahydrophthaloylchlorid |
| Synonyme |
trans-5-Norbornen-2,3-dicarbonylchlorid; Bicyclo[2.2.1]-5-hepten-2,3-dicarbonylchlorid; Bicyclo[2.2.1]hept-5-en-2,3-dicarbonyldichlorid; (1R,2S,3S,4S)-bicyclo[2.2.1]hept-5-en-2,3-dicarbonyldichlorid |
| Englischer Name |
trans-3,6-endo-Methylene-1,2,3,6-tetrahydrophthaloyl chloride; trans-5-Norbornene-2,3-dicarbonyl chloride; Bicyclo[2.2.1]-5-heptene-2,3-dicarbonyl Chloride; bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl dichloride; (1R,2S,3S,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl dichloride |
| Molekulare Formel |
C9H8Cl2O2 |
| Molecular Weight |
219.0646 |
| InChI |
InChI=1/C9H8Cl2O2/c10-8(12)6-4-1-2-5(3-4)7(6)9(11)13/h1-2,4-7H,3H2/t4-,5+,6-,7-/m0/s1 |
| CAS Registry Number |
4582-21-2 |
| EINECS |
224-967-5 |
| Molecular Structure |
|
| Dichte |
1.453g/cm3 |
| Siedepunkt |
243.334°C at 760 mmHg |
| Brechungsindex |
1.56 |
| Flammpunkt |
133.454°C |
| Dampfdruck |
0.032mmHg at 25°C |
| Gefahrensymbole |
C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|